CAS 1000578-01-7 is the registry number for 2,6-Dibromo-4-fluorophenyl isothiocyanate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1,3-dibromo-5-fluoro-2-isothiocyanatobenzene (CAS 1000578-01-7) is a chemical compound with the molecular formula C7H2Br2FNS and a molecular weight of 310.97 g/mol. IUPAC name: 1,3-dibromo-5-fluoro-2-isothiocyanatobenzene. InChIKey: HFDLRDHWGQFRAR-UHFFFAOYSA-N.
| Molecular formula | C7H2Br2FNS |
|---|---|
| Molecular weight | 310.97 g/mol |
| IUPAC name | 1,3-dibromo-5-fluoro-2-isothiocyanatobenzene |
| InChIKey | HFDLRDHWGQFRAR-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Br)N=C=S)Br)F |
Computed by PubChem (NCBI)