CAS 1427426-59-2 appears in our catalog under these names: 2,5-Dibromo-4-fluorobenzo[d]thiazole, 95%, 2,5–Dibromo–4–fluorobenzo(d)thiazole, 2,5-Dibromo-4-fluoro-1,3-benzothiazole, 2,5-dibromo-4-fluoro-Benzothiazole, 97%, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 500mg, 0,5g, 5g.
2,5-dibromo-4-fluoro-1,3-benzothiazole (CAS 1427426-59-2) is a chemical compound with the molecular formula C7H2Br2FNS and a molecular weight of 310.97 g/mol. IUPAC name: 2,5-dibromo-4-fluoro-1,3-benzothiazole. InChIKey: LSYHSGURCDEIDB-UHFFFAOYSA-N.
| Molecular formula | C7H2Br2FNS |
|---|---|
| Molecular weight | 310.97 g/mol |
| IUPAC name | 2,5-dibromo-4-fluoro-1,3-benzothiazole |
| InChIKey | LSYHSGURCDEIDB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1SC(=N2)Br)F)Br |
Computed by PubChem (NCBI)