CAS 244022-67-1 is the registry number for 2,4-Dibromo-6-fluorophenyl isothiocyanate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1,5-dibromo-3-fluoro-2-isothiocyanatobenzene (CAS 244022-67-1) is a chemical compound with the molecular formula C7H2Br2FNS and a molecular weight of 310.97 g/mol. IUPAC name: 1,5-dibromo-3-fluoro-2-isothiocyanatobenzene. InChIKey: VDTMHXBNLSMARZ-UHFFFAOYSA-N.
| Molecular formula | C7H2Br2FNS |
|---|---|
| Molecular weight | 310.97 g/mol |
| IUPAC name | 1,5-dibromo-3-fluoro-2-isothiocyanatobenzene |
| InChIKey | VDTMHXBNLSMARZ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)N=C=S)Br)Br |
Computed by PubChem (NCBI)