CAS 1000590-53-3 is the registry number for COX-2-IN-56. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[2-(2,4-dichloro-3-methylanilino)-5-methylphenyl]acetic acid (CAS 1000590-53-3) is a chemical compound with the molecular formula C16H15Cl2NO2 and a molecular weight of 324.2 g/mol. IUPAC name: 2-[2-(2,4-dichloro-3-methylanilino)-5-methylphenyl]acetic acid. InChIKey: BSCGZOZNKPEXSS-UHFFFAOYSA-N.
| Molecular formula | C16H15Cl2NO2 |
|---|---|
| Molecular weight | 324.2 g/mol |
| IUPAC name | 2-[2-(2,4-dichloro-3-methylanilino)-5-methylphenyl]acetic acid |
| InChIKey | BSCGZOZNKPEXSS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)NC2=C(C(=C(C=C2)Cl)C)Cl)CC(=O)O |
Computed by PubChem (NCBI)