CAS 1157325-96-6 appears in our catalog under these names: 4-{(1-(2,5-dichlorophenyl)ethyl)amino}-3-methylbenzoic acid, 95%, 4-{(1-(2,5-Dichlorophenyl)ethyl)amino}-3-methylbenzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
4-[1-(2,5-dichlorophenyl)ethylamino]-3-methylbenzoic acid (CAS 1157325-96-6) is a chemical compound with the molecular formula C16H15Cl2NO2 and a molecular weight of 324.2 g/mol. IUPAC name: 4-[1-(2,5-dichlorophenyl)ethylamino]-3-methylbenzoic acid. InChIKey: CRXPUBPTCBZHOB-UHFFFAOYSA-N.
| Molecular formula | C16H15Cl2NO2 |
|---|---|
| Molecular weight | 324.2 g/mol |
| IUPAC name | 4-[1-(2,5-dichlorophenyl)ethylamino]-3-methylbenzoic acid |
| InChIKey | CRXPUBPTCBZHOB-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C(=O)O)NC(C)C2=C(C=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)