CAS 2750499-72-8 is the registry number for (R)-(4-Benzyl-6,8-dichloro-3,4-dihydro-2H-benzo[b][1,4]oxazin-2-yl)methanol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[(2R)-4-benzyl-6,8-dichloro-2,3-dihydro-1,4-benzoxazin-2-yl]methanol (CAS 2750499-72-8) is a chemical compound with the molecular formula C16H15Cl2NO2 and a molecular weight of 324.2 g/mol. IUPAC name: [(2R)-4-benzyl-6,8-dichloro-2,3-dihydro-1,4-benzoxazin-2-yl]methanol. InChIKey: XBRXUTRNZTVTDE-CYBMUJFWSA-N.
| Molecular formula | C16H15Cl2NO2 |
|---|---|
| Molecular weight | 324.2 g/mol |
| IUPAC name | [(2R)-4-benzyl-6,8-dichloro-2,3-dihydro-1,4-benzoxazin-2-yl]methanol |
| InChIKey | XBRXUTRNZTVTDE-CYBMUJFWSA-N |
| SMILES | C1[C@@H](OC2=C(N1CC3=CC=CC=C3)C=C(C=C2Cl)Cl)CO |
Computed by PubChem (NCBI)