Products 100066-79-3

CAS 100066-79-3 is the registry number for 1-Benzyl-2-amino-3-tert-butoxycarbonyl-4,5-dimethylpyrrole, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Tert-butyl 2-amino-1-benzyl-4,5-dimethylpyrrole-3-carboxylate (CAS 100066-79-3) is a chemical compound with the molecular formula C18H24N2O2 and a molecular weight of 300.4 g/mol. IUPAC name: tert-butyl 2-amino-1-benzyl-4,5-dimethylpyrrole-3-carboxylate. InChIKey: IIESIUNVGNNCNR-UHFFFAOYSA-N.

Identity
Molecular formulaC18H24N2O2
Molecular weight300.4 g/mol
IUPAC nametert-butyl 2-amino-1-benzyl-4,5-dimethylpyrrole-3-carboxylate
InChIKeyIIESIUNVGNNCNR-UHFFFAOYSA-N
SMILESCC1=C(N(C(=C1C(=O)OC(C)(C)C)N)CC2=CC=CC=C2)C

Computed by PubChem (NCBI)