CAS 100066-79-3 is the registry number for 1-Benzyl-2-amino-3-tert-butoxycarbonyl-4,5-dimethylpyrrole, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Tert-butyl 2-amino-1-benzyl-4,5-dimethylpyrrole-3-carboxylate (CAS 100066-79-3) is a chemical compound with the molecular formula C18H24N2O2 and a molecular weight of 300.4 g/mol. IUPAC name: tert-butyl 2-amino-1-benzyl-4,5-dimethylpyrrole-3-carboxylate. InChIKey: IIESIUNVGNNCNR-UHFFFAOYSA-N.
| Molecular formula | C18H24N2O2 |
|---|---|
| Molecular weight | 300.4 g/mol |
| IUPAC name | tert-butyl 2-amino-1-benzyl-4,5-dimethylpyrrole-3-carboxylate |
| InChIKey | IIESIUNVGNNCNR-UHFFFAOYSA-N |
| SMILES | CC1=C(N(C(=C1C(=O)OC(C)(C)C)N)CC2=CC=CC=C2)C |
Computed by PubChem (NCBI)