Products 1227162-74-4
CAS 1227162-74-4 appears in our catalog under these names: Palonosetron Impurity 11, Palonosetron 8-Hydroxy 1-Carboxamide. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
N-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-8-hydroxy-5,6,7,8-tetrahydronaphthalene-1-carboxamide (CAS 1227162-74-4) is a chemical compound with the molecular formula C18H24N2O2 and a molecular weight of 300.4 g/mol. IUPAC name: N-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-8-hydroxy-5,6,7,8-tetrahydronaphthalene-1-carboxamide. InChIKey: JFJFGAXBBDZTEE-AAFJCEBUSA-N.
| Molecular formula | C18H24N2O2 |
|---|---|
| Molecular weight | 300.4 g/mol |
| IUPAC name | N-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-8-hydroxy-5,6,7,8-tetrahydronaphthalene-1-carboxamide |
| InChIKey | JFJFGAXBBDZTEE-AAFJCEBUSA-N |
| SMILES | C1CC(C2=C(C1)C=CC=C2C(=O)N[C@@H]3CN4CCC3CC4)O |
Computed by PubChem (NCBI)