CAS 2640520-11-0 is the registry number for (1S,2S)-1,2-Bis(4-methoxyphenyl)-N1,N2-dimethylethane-1,2-diamine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S,2S)-1,2-bis(4-methoxyphenyl)-N,N'-dimethylethane-1,2-diamine (CAS 2640520-11-0) is a chemical compound with the molecular formula C18H24N2O2 and a molecular weight of 300.4 g/mol. IUPAC name: (1S,2S)-1,2-bis(4-methoxyphenyl)-N,N'-dimethylethane-1,2-diamine. InChIKey: DGIPOKRRLDGGEE-ROUUACIJSA-N.
| Molecular formula | C18H24N2O2 |
|---|---|
| Molecular weight | 300.4 g/mol |
| IUPAC name | (1S,2S)-1,2-bis(4-methoxyphenyl)-N,N'-dimethylethane-1,2-diamine |
| InChIKey | DGIPOKRRLDGGEE-ROUUACIJSA-N |
| SMILES | CN[C@@H](C1=CC=C(C=C1)OC)[C@H](C2=CC=C(C=C2)OC)NC |
Computed by PubChem (NCBI)