CAS 1000770-97-7 appears in our catalog under these names: (S)-2-((tert-Butoxycarbonyl)amino)-3-(3-methyl-3H-diazirin-3-yl)propanoic acid, 95%, Boc-L-Photo-Leucine*DCHA. Offered by: AmBeed, Iris Biotech. Available pack sizes: 5g, 1g, 100mg, 250mg.
(2S)-3-(3-methyldiazirin-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 1000770-97-7) is a chemical compound with the molecular formula C10H17N3O4 and a molecular weight of 243.26 g/mol. IUPAC name: (2S)-3-(3-methyldiazirin-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: OMAJGFBHQOFABU-LURJTMIESA-N.
| Molecular formula | C10H17N3O4 |
|---|---|
| Molecular weight | 243.26 g/mol |
| IUPAC name | (2S)-3-(3-methyldiazirin-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | OMAJGFBHQOFABU-LURJTMIESA-N |
| SMILES | CC1(N=N1)C[C@@H](C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)