CAS 2095409-43-9 is the registry number for 2-{((tert-butoxy)carbonyl)amino}-3-(3-methyl-3H-diazirin-3-yl)propanoic acid, 95%. Offered by: AmBeed. Available pack sizes: 1g.
3-(3-methyldiazirin-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 2095409-43-9) is a chemical compound with the molecular formula C10H17N3O4 and a molecular weight of 243.26 g/mol. IUPAC name: 3-(3-methyldiazirin-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: OMAJGFBHQOFABU-UHFFFAOYSA-N.
| Molecular formula | C10H17N3O4 |
|---|---|
| Molecular weight | 243.26 g/mol |
| IUPAC name | 3-(3-methyldiazirin-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | OMAJGFBHQOFABU-UHFFFAOYSA-N |
| SMILES | CC1(N=N1)CC(C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)