Products 5040-21-1
CAS 5040-21-1 appears in our catalog under these names: 2’-Deoxy-N3-methylcytidine, 2’-Deoxy-N3-methylcytidine. Offered by: Biosynth, MedChemExpress. Available pack sizes: 250mg, 100mg, 500mg, 1000mg, Get quote.
4-amino-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-methyl-4H-pyrimidin-2-one (CAS 5040-21-1) is a chemical compound with the molecular formula C10H17N3O4 and a molecular weight of 243.26 g/mol. IUPAC name: 4-amino-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-methyl-4H-pyrimidin-2-one. InChIKey: LVMJWUXGGRMAIW-QRDCSKFFSA-N.
| Molecular formula | C10H17N3O4 |
|---|---|
| Molecular weight | 243.26 g/mol |
| IUPAC name | 4-amino-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-methyl-4H-pyrimidin-2-one |
| InChIKey | LVMJWUXGGRMAIW-QRDCSKFFSA-N |
| SMILES | CN1C(C=CN(C1=O)[C@H]2C[C@@H]([C@H](O2)CO)O)N |
Computed by PubChem (NCBI)