CAS 1000853-53-1 appears in our catalog under these names: (R)-1-Boc-2-Methylpiperazine hydrochloride, 95%, (R)–tert–Butyl 2–methylpiperazine–1–carboxylate hydrochloride, (R)-tert-Butyl 2-methylpiperazine-1-carboxylate hydrochloride, 95%, 95%, (R)-tert-Butyl 2-methylpiperazine-1-carboxylate hydrochloride, 95%. Offered by: Fluorochem, GLPBio, Chemat, Ambeed. Available pack sizes: 1g, 100g, 100mg, 5g, 10g, 25g.
Tert-butyl (2R)-2-methylpiperazine-1-carboxylate;hydrochloride (CAS 1000853-53-1) is a chemical compound with the molecular formula C10H21ClN2O2 and a molecular weight of 236.74 g/mol. IUPAC name: tert-butyl (2R)-2-methylpiperazine-1-carboxylate;hydrochloride. InChIKey: CAKKNXNGNSFBHG-DDWIOCJRSA-N.
| Molecular formula | C10H21ClN2O2 |
|---|---|
| Molecular weight | 236.74 g/mol |
| IUPAC name | tert-butyl (2R)-2-methylpiperazine-1-carboxylate;hydrochloride |
| InChIKey | CAKKNXNGNSFBHG-DDWIOCJRSA-N |
| SMILES | C[C@@H]1CNCCN1C(=O)OC(C)(C)C.Cl |
Computed by PubChem (NCBI)