CAS 1000930-92-6 is the registry number for 2-Chloro-1-(8-fluoro-1,2,3,4-tetrahydroquinolin-1-yl)ethan-1-one, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-chloro-1-(8-fluoro-3,4-dihydro-2H-quinolin-1-yl)ethanone (CAS 1000930-92-6) is a chemical compound with the molecular formula C11H11ClFNO and a molecular weight of 227.66 g/mol. IUPAC name: 2-chloro-1-(8-fluoro-3,4-dihydro-2H-quinolin-1-yl)ethanone. InChIKey: VTFJAHBKYAKGFZ-UHFFFAOYSA-N.
| Molecular formula | C11H11ClFNO |
|---|---|
| Molecular weight | 227.66 g/mol |
| IUPAC name | 2-chloro-1-(8-fluoro-3,4-dihydro-2H-quinolin-1-yl)ethanone |
| InChIKey | VTFJAHBKYAKGFZ-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C(=CC=C2)F)N(C1)C(=O)CCl |
Computed by PubChem (NCBI)