Products 1000932-01-3

CAS 1000932-01-3 is the registry number for 4-(Chlorosulfonyl)-1-methyl-1h-pyrrole-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

4-chlorosulfonyl-1-methylpyrrole-2-carboxylic acid (CAS 1000932-01-3) is a chemical compound with the molecular formula C6H6ClNO4S and a molecular weight of 223.63 g/mol. IUPAC name: 4-chlorosulfonyl-1-methylpyrrole-2-carboxylic acid. InChIKey: POMZQIUIOJIHIN-UHFFFAOYSA-N.

Identity
Molecular formulaC6H6ClNO4S
Molecular weight223.63 g/mol
IUPAC name4-chlorosulfonyl-1-methylpyrrole-2-carboxylic acid
InChIKeyPOMZQIUIOJIHIN-UHFFFAOYSA-N
SMILESCN1C=C(C=C1C(=O)O)S(=O)(=O)Cl

Computed by PubChem (NCBI)