CAS 88-23-3 appears in our catalog under these names: 3-Amino-5-chloro-2-hydroxybenzenesulfonic acid, 99%, 2-Amino-4-chlorophenol-6-sulfonic acid, 98%, 2-Amino-4-chlorophenol-6-sulfonic Acid, >99.0%(HPLC)(T), 3-Amino-5-chloro-2-hydroxybenzenesulfonic acid, 80%, 80%, 3-Amino-5-chloro-2-hydroxybenzenesulfonic acid, ≥99%(HPLC)(T). Offered by: AmBeed, Combi-blocks, TCI, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 100g.
3-amino-5-chloro-2-hydroxybenzenesulfonic acid (CAS 88-23-3) is a chemical compound with the molecular formula C6H6ClNO4S and a molecular weight of 223.63 g/mol. IUPAC name: 3-amino-5-chloro-2-hydroxybenzenesulfonic acid. InChIKey: YCTAOQGPWNTYJE-UHFFFAOYSA-N.
| Molecular formula | C6H6ClNO4S |
|---|---|
| Molecular weight | 223.63 g/mol |
| IUPAC name | 3-amino-5-chloro-2-hydroxybenzenesulfonic acid |
| InChIKey | YCTAOQGPWNTYJE-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1N)O)S(=O)(=O)O)Cl |
Computed by PubChem (NCBI)