Products 1490847-28-3

CAS 1490847-28-3 appears in our catalog under these names: 5-Carbamoyl-2-methylfuran-3-sulfonyl chloride, 5-Carbamoyl-2-methylfuran-3-sulfonyl chloride, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.

5-carbamoyl-2-methylfuran-3-sulfonyl chloride (CAS 1490847-28-3) is a chemical compound with the molecular formula C6H6ClNO4S and a molecular weight of 223.63 g/mol. IUPAC name: 5-carbamoyl-2-methylfuran-3-sulfonyl chloride. InChIKey: DSHMBSMSPMTIRP-UHFFFAOYSA-N.

Identity
Molecular formulaC6H6ClNO4S
Molecular weight223.63 g/mol
IUPAC name5-carbamoyl-2-methylfuran-3-sulfonyl chloride
InChIKeyDSHMBSMSPMTIRP-UHFFFAOYSA-N
SMILESCC1=C(C=C(O1)C(=O)N)S(=O)(=O)Cl

Computed by PubChem (NCBI)