CAS 1000932-24-0 is the registry number for 5-(Chloromethyl)-N-((4-methylphenyl)methyl)-1,3,4-thiadiazole-2-carboxamide, 95%. Offered by: AmBeed. Available pack sizes: 5g.
5-(chloromethyl)-N-[(4-methylphenyl)methyl]-1,3,4-thiadiazole-2-carboxamide (CAS 1000932-24-0) is a chemical compound with the molecular formula C12H12ClN3OS and a molecular weight of 281.76 g/mol. IUPAC name: 5-(chloromethyl)-N-[(4-methylphenyl)methyl]-1,3,4-thiadiazole-2-carboxamide. InChIKey: LWKPWOKNZHXRJR-UHFFFAOYSA-N.
| Molecular formula | C12H12ClN3OS |
|---|---|
| Molecular weight | 281.76 g/mol |
| IUPAC name | 5-(chloromethyl)-N-[(4-methylphenyl)methyl]-1,3,4-thiadiazole-2-carboxamide |
| InChIKey | LWKPWOKNZHXRJR-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)CNC(=O)C2=NN=C(S2)CCl |
Computed by PubChem (NCBI)