CAS 946386-90-9 is the registry number for (2-Chlorophenyl)(3-((hydroxyimino)ethyl)-4-methyl(2,5-thiazolyl))amine. Offered by: Biosynth. Available pack sizes: 5000mg.
N-[1-[2-(2-chloroanilino)-4-methyl-1,3-thiazol-5-yl]ethylidene]hydroxylamine (CAS 946386-90-9) is a chemical compound with the molecular formula C12H12ClN3OS and a molecular weight of 281.76 g/mol. IUPAC name: N-[1-[2-(2-chloroanilino)-4-methyl-1,3-thiazol-5-yl]ethylidene]hydroxylamine. InChIKey: ZAUCSGZMBHAXEU-UHFFFAOYSA-N.
| Molecular formula | C12H12ClN3OS |
|---|---|
| Molecular weight | 281.76 g/mol |
| IUPAC name | N-[1-[2-(2-chloroanilino)-4-methyl-1,3-thiazol-5-yl]ethylidene]hydroxylamine |
| InChIKey | ZAUCSGZMBHAXEU-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)NC2=CC=CC=C2Cl)C(=NO)C |
Computed by PubChem (NCBI)