CAS 67944-07-4 is the registry number for 1-(4-Chlorophenyl)-2-((5-ethyl-1H-1,2,4-triazol-3-yl)thio)ethan-1-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(4-chlorophenyl)-2-[(5-ethyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethanone (CAS 67944-07-4) is a chemical compound with the molecular formula C12H12ClN3OS and a molecular weight of 281.76 g/mol. IUPAC name: 1-(4-chlorophenyl)-2-[(5-ethyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethanone. InChIKey: MIGFRZGGPVDJFI-UHFFFAOYSA-N.
| Molecular formula | C12H12ClN3OS |
|---|---|
| Molecular weight | 281.76 g/mol |
| IUPAC name | 1-(4-chlorophenyl)-2-[(5-ethyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethanone |
| InChIKey | MIGFRZGGPVDJFI-UHFFFAOYSA-N |
| SMILES | CCC1=NC(=NN1)SCC(=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)