CAS 1000932-67-1 appears in our catalog under these names: 1-Sulfamoylpiperidine-4-carboxylic Acid, 1-Sulfamoylpiperidine-4-carboxylic acid, 95%, 1-Sulfamoylpiperidine-4-carboxylic acid, 97%. Offered by: TRC, Biosynth, Combi-blocks, AmBeed. Available pack sizes: 750mg, 100mg, 1g, 10g, 5g, 250mg.
1-sulfamoylpiperidine-4-carboxylic acid (CAS 1000932-67-1) is a chemical compound with the molecular formula C6H12N2O4S and a molecular weight of 208.24 g/mol. IUPAC name: 1-sulfamoylpiperidine-4-carboxylic acid. InChIKey: RHSCFCIWXIKLFP-UHFFFAOYSA-N.
| Molecular formula | C6H12N2O4S |
|---|---|
| Molecular weight | 208.24 g/mol |
| IUPAC name | 1-sulfamoylpiperidine-4-carboxylic acid |
| InChIKey | RHSCFCIWXIKLFP-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1C(=O)O)S(=O)(=O)N |
Computed by PubChem (NCBI)