Products 140165-55-5
CAS 140165-55-5 appears in our catalog under these names: Tinidazole Impurity 9, Tinidazole Impurity 6. Offered by: Chemat Brand. Available pack sizes: on request.
N'-(2-ethylsulfonylethyl)oxamide (CAS 140165-55-5) is a chemical compound with the molecular formula C6H12N2O4S and a molecular weight of 208.24 g/mol. IUPAC name: N'-(2-ethylsulfonylethyl)oxamide. InChIKey: PUGFDHBZYJCGGG-UHFFFAOYSA-N.
| Molecular formula | C6H12N2O4S |
|---|---|
| Molecular weight | 208.24 g/mol |
| IUPAC name | N'-(2-ethylsulfonylethyl)oxamide |
| InChIKey | PUGFDHBZYJCGGG-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)CCNC(=O)C(=O)N |
Computed by PubChem (NCBI)