Products 97345-90-9

CAS 97345-90-9 appears in our catalog under these names: 1,3-Dimethylimidazolium methyl sulfate, 95%, 1,3-Dimethylimidazolium Methyl Sulfate, >98.0%(HPLC)(N), 1,3-Dimethyl-1H-imidazol-3-ium methyl sulfate 98%, 1,3-Dimethyl-1H-imidazol-3-ium methyl sulfate, 98%, 98%, 1,3-Dimethyl-1H-imidazol-3-ium methyl sulfate, 98%. Offered by: Combi-blocks, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 100g.

Structural formula: {0} (CAS {1})

1,3-dimethylimidazol-1-ium;methyl sulfate (CAS 97345-90-9) is a chemical compound with the molecular formula C6H12N2O4S and a molecular weight of 208.24 g/mol. IUPAC name: 1,3-dimethylimidazol-1-ium;methyl sulfate. InChIKey: WOKQGMYCUGJNIJ-UHFFFAOYSA-M.

Identity
Molecular formulaC6H12N2O4S
Molecular weight208.24 g/mol
IUPAC name1,3-dimethylimidazol-1-ium;methyl sulfate
InChIKeyWOKQGMYCUGJNIJ-UHFFFAOYSA-M
SMILESCN1C=C[N+](=C1)C.COS(=O)(=O)[O-]

Computed by PubChem (NCBI)