CAS 97345-90-9 appears in our catalog under these names: 1,3-Dimethylimidazolium methyl sulfate, 95%, 1,3-Dimethylimidazolium Methyl Sulfate, >98.0%(HPLC)(N), 1,3-Dimethyl-1H-imidazol-3-ium methyl sulfate 98%, 1,3-Dimethyl-1H-imidazol-3-ium methyl sulfate, 98%, 98%, 1,3-Dimethyl-1H-imidazol-3-ium methyl sulfate, 98%. Offered by: Combi-blocks, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 100g.
1,3-dimethylimidazol-1-ium;methyl sulfate (CAS 97345-90-9) is a chemical compound with the molecular formula C6H12N2O4S and a molecular weight of 208.24 g/mol. IUPAC name: 1,3-dimethylimidazol-1-ium;methyl sulfate. InChIKey: WOKQGMYCUGJNIJ-UHFFFAOYSA-M.
| Molecular formula | C6H12N2O4S |
|---|---|
| Molecular weight | 208.24 g/mol |
| IUPAC name | 1,3-dimethylimidazol-1-ium;methyl sulfate |
| InChIKey | WOKQGMYCUGJNIJ-UHFFFAOYSA-M |
| SMILES | CN1C=C[N+](=C1)C.COS(=O)(=O)[O-] |
Computed by PubChem (NCBI)