CAS 1001048-70-9 is the registry number for 2-((benzo(3,4-d)1,3-dioxolen-5-ylamino)methylene)indane-1,3-dione. Offered by: Biosynth. Available pack sizes: 250mg.
2-(1,3-benzodioxol-5-yliminomethyl)-3-hydroxyinden-1-one (CAS 1001048-70-9) is a chemical compound with the molecular formula C17H11NO4 and a molecular weight of 293.27 g/mol. IUPAC name: 2-(1,3-benzodioxol-5-yliminomethyl)-3-hydroxyinden-1-one. InChIKey: MMQZSOKFIURURO-UHFFFAOYSA-N.
| Molecular formula | C17H11NO4 |
|---|---|
| Molecular weight | 293.27 g/mol |
| IUPAC name | 2-(1,3-benzodioxol-5-yliminomethyl)-3-hydroxyinden-1-one |
| InChIKey | MMQZSOKFIURURO-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)N=CC3=C(C4=CC=CC=C4C3=O)O |
Computed by PubChem (NCBI)