Products 1195529-07-7
CAS 1195529-07-7 appears in our catalog under these names: 1,3-Dioxoisoindolin-2-yl cinnamate 97% (E), 1,3-Dioxoisoindolin-2-yl cinnamate, 97%, 97%, 1,3-Dioxoisoindolin-2-yl cinnamate, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g.
(1,3-dioxoisoindol-2-yl) (E)-3-phenylprop-2-enoate (CAS 1195529-07-7) is a chemical compound with the molecular formula C17H11NO4 and a molecular weight of 293.27 g/mol. IUPAC name: (1,3-dioxoisoindol-2-yl) (E)-3-phenylprop-2-enoate. InChIKey: RWBPSIPMHURWQQ-ZHACJKMWSA-N.
| Molecular formula | C17H11NO4 |
|---|---|
| Molecular weight | 293.27 g/mol |
| IUPAC name | (1,3-dioxoisoindol-2-yl) (E)-3-phenylprop-2-enoate |
| InChIKey | RWBPSIPMHURWQQ-ZHACJKMWSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/C(=O)ON2C(=O)C3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)