Products 19585-90-1
CAS 19585-90-1 is the registry number for 3-Phenylquinoline-2,4-dicarboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-phenylquinoline-2,4-dicarboxylic acid (CAS 19585-90-1) is a chemical compound with the molecular formula C17H11NO4 and a molecular weight of 293.27 g/mol. IUPAC name: 3-phenylquinoline-2,4-dicarboxylic acid. InChIKey: BEJHKUKBANBLMR-UHFFFAOYSA-N.
| Molecular formula | C17H11NO4 |
|---|---|
| Molecular weight | 293.27 g/mol |
| IUPAC name | 3-phenylquinoline-2,4-dicarboxylic acid |
| InChIKey | BEJHKUKBANBLMR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C3=CC=CC=C3N=C2C(=O)O)C(=O)O |
Computed by PubChem (NCBI)