CAS 1001124-90-8 appears in our catalog under these names: 1-(tert-Butoxycarbonyl)-4-(3-chlorophenyl)piperidine-4-carboxylic acid, 95%, 1-(TERT-BUTOXYCARBONYL)-4-(3-CHLOROPHENYL)PIPERIDINE-4-CARBOXYLIC ACID, 97%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 500mg, 5g.
4-(3-chlorophenyl)-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid (CAS 1001124-90-8) is a chemical compound with the molecular formula C17H22ClNO4 and a molecular weight of 339.8 g/mol. IUPAC name: 4-(3-chlorophenyl)-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid. InChIKey: CWHKDJGMAAWEPY-UHFFFAOYSA-N.
| Molecular formula | C17H22ClNO4 |
|---|---|
| Molecular weight | 339.8 g/mol |
| IUPAC name | 4-(3-chlorophenyl)-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid |
| InChIKey | CWHKDJGMAAWEPY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)(C2=CC(=CC=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)