Products 362044-01-7
CAS 362044-01-7 is the registry number for N-Demethyl Cocaethylene Hydrochloride. Offered by: TRC. Available pack sizes: 100mg, 10mg.
Ethyl (1R,2R,3S,5S)-3-benzoyloxy-8-azabicyclo[3.2.1]octane-2-carboxylate;hydrochloride (CAS 362044-01-7) is a chemical compound with the molecular formula C17H22ClNO4 and a molecular weight of 339.8 g/mol. IUPAC name: ethyl (1R,2R,3S,5S)-3-benzoyloxy-8-azabicyclo[3.2.1]octane-2-carboxylate;hydrochloride. InChIKey: VZTBLUHOIGKCJL-VZXSFKIWSA-N.
| Molecular formula | C17H22ClNO4 |
|---|---|
| Molecular weight | 339.8 g/mol |
| IUPAC name | ethyl (1R,2R,3S,5S)-3-benzoyloxy-8-azabicyclo[3.2.1]octane-2-carboxylate;hydrochloride |
| InChIKey | VZTBLUHOIGKCJL-VZXSFKIWSA-N |
| SMILES | CCOC(=O)[C@@H]1[C@H]2CC[C@H](N2)C[C@@H]1OC(=O)C3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)