CAS 109582-53-8 appears in our catalog under these names: Allopseudococaine Hydrochloride (1mg/ml in Acetonitrile), Allopseudococaine Hydrochloride, >95% (HPLC). Offered by: TRC. Available pack sizes: 5x1ml, 100mg, 10mg.
Methyl (1R)-3-benzoyloxy-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate;hydrochloride (CAS 109582-53-8) is a chemical compound with the molecular formula C17H22ClNO4 and a molecular weight of 339.8 g/mol. IUPAC name: methyl (1R)-3-benzoyloxy-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate;hydrochloride. InChIKey: PIQVDUKEQYOJNR-IHBSAOCSSA-N.
| Molecular formula | C17H22ClNO4 |
|---|---|
| Molecular weight | 339.8 g/mol |
| IUPAC name | methyl (1R)-3-benzoyloxy-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate;hydrochloride |
| InChIKey | PIQVDUKEQYOJNR-IHBSAOCSSA-N |
| SMILES | CN1[C@@H]2CCC1CC(C2C(=O)OC)OC(=O)C3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)