CAS 1001288-58-9 appears in our catalog under these names: (E)-2-((3-(3-Methoxy-4-propargyloxyphenyl)-1-oxo-2-propenyl)amino)benzoic Acid, FT011/ 98%, FT011, FT011, 98%, 98%, FT011, 99.32%. Offered by: TRC, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 250mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 10mM (in 1ml dmso).
2-[[(E)-3-(3-methoxy-4-prop-2-ynoxyphenyl)prop-2-enoyl]amino]benzoic acid (CAS 1001288-58-9) is a chemical compound with the molecular formula C20H17NO5 and a molecular weight of 351.4 g/mol. IUPAC name: 2-[[(E)-3-(3-methoxy-4-prop-2-ynoxyphenyl)prop-2-enoyl]amino]benzoic acid. InChIKey: UIWZIDIJCUEOMT-PKNBQFBNSA-N.
| Molecular formula | C20H17NO5 |
|---|---|
| Molecular weight | 351.4 g/mol |
| IUPAC name | 2-[[(E)-3-(3-methoxy-4-prop-2-ynoxyphenyl)prop-2-enoyl]amino]benzoic acid |
| InChIKey | UIWZIDIJCUEOMT-PKNBQFBNSA-N |
| SMILES | COC1=C(C=CC(=C1)/C=C/C(=O)NC2=CC=CC=C2C(=O)O)OCC#C |
Computed by PubChem (NCBI)