CAS 2451479-66-4 is the registry number for hCAXII-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
(E)-3-(3,4-dimethoxyphenyl)-N-(2-oxochromen-6-yl)prop-2-enamide (CAS 2451479-66-4) is a chemical compound with the molecular formula C20H17NO5 and a molecular weight of 351.4 g/mol. IUPAC name: (E)-3-(3,4-dimethoxyphenyl)-N-(2-oxochromen-6-yl)prop-2-enamide. InChIKey: VTURXSGSWBEJIN-RUDMXATFSA-N.
| Molecular formula | C20H17NO5 |
|---|---|
| Molecular weight | 351.4 g/mol |
| IUPAC name | (E)-3-(3,4-dimethoxyphenyl)-N-(2-oxochromen-6-yl)prop-2-enamide |
| InChIKey | VTURXSGSWBEJIN-RUDMXATFSA-N |
| SMILES | COC1=C(C=C(C=C1)/C=C/C(=O)NC2=CC3=C(C=C2)OC(=O)C=C3)OC |
Computed by PubChem (NCBI)