CAS 2137820-81-4 is the registry number for 1-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-oxocyclobutanecarboxylic acid, 93%, 93%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
1-(9H-fluoren-9-ylmethoxycarbonylamino)-3-oxocyclobutane-1-carboxylic acid (CAS 2137820-81-4) is a chemical compound with the molecular formula C20H17NO5 and a molecular weight of 351.4 g/mol. IUPAC name: 1-(9H-fluoren-9-ylmethoxycarbonylamino)-3-oxocyclobutane-1-carboxylic acid. InChIKey: OAFXGBKPEIQRAM-UHFFFAOYSA-N.
| Molecular formula | C20H17NO5 |
|---|---|
| Molecular weight | 351.4 g/mol |
| IUPAC name | 1-(9H-fluoren-9-ylmethoxycarbonylamino)-3-oxocyclobutane-1-carboxylic acid |
| InChIKey | OAFXGBKPEIQRAM-UHFFFAOYSA-N |
| SMILES | C1C(=O)CC1(C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)