CAS 100130-48-1 appears in our catalog under these names: 5-Chloro-2,1,3-benzothiadiazole-4-sulfonyl chloride, 95%, 5-CHLORO-2,1,3-BENZOTHIADIAZOLE-4-SULFONYL CHLORIDE, 95+%, 95+%, 5-chloro-2,1,3-benzothiadiazole-4-sulfonyl chloride, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100mg.
5-chloro-2,1,3-benzothiadiazole-4-sulfonyl chloride (CAS 100130-48-1) is a chemical compound with the molecular formula C6H2Cl2N2O2S2 and a molecular weight of 269.1 g/mol. IUPAC name: 5-chloro-2,1,3-benzothiadiazole-4-sulfonyl chloride. InChIKey: JLRRVYGVTOFMCM-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl2N2O2S2 |
|---|---|
| Molecular weight | 269.1 g/mol |
| IUPAC name | 5-chloro-2,1,3-benzothiadiazole-4-sulfonyl chloride |
| InChIKey | JLRRVYGVTOFMCM-UHFFFAOYSA-N |
| SMILES | C1=CC2=NSN=C2C(=C1Cl)S(=O)(=O)Cl |
Computed by PubChem (NCBI)