CAS 1155084-27-7 is the registry number for 4-Chlorothieno(2,3-d)pyrimidine-6-sulfonyl chloride, 98%. Offered by: AmBeed. Available pack sizes: 10g, 5g, 1g.
4-chlorothieno[2,3-d]pyrimidine-6-sulfonyl chloride (CAS 1155084-27-7) is a chemical compound with the molecular formula C6H2Cl2N2O2S2 and a molecular weight of 269.1 g/mol. IUPAC name: 4-chlorothieno[2,3-d]pyrimidine-6-sulfonyl chloride. InChIKey: BUWGXOIEWUGBOA-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl2N2O2S2 |
|---|---|
| Molecular weight | 269.1 g/mol |
| IUPAC name | 4-chlorothieno[2,3-d]pyrimidine-6-sulfonyl chloride |
| InChIKey | BUWGXOIEWUGBOA-UHFFFAOYSA-N |
| SMILES | C1=C(SC2=C1C(=NC=N2)Cl)S(=O)(=O)Cl |
Computed by PubChem (NCBI)