Products 1155084-27-7

CAS 1155084-27-7 is the registry number for 4-Chlorothieno(2,3-d)pyrimidine-6-sulfonyl chloride, 98%. Offered by: AmBeed. Available pack sizes: 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

4-chlorothieno[2,3-d]pyrimidine-6-sulfonyl chloride (CAS 1155084-27-7) is a chemical compound with the molecular formula C6H2Cl2N2O2S2 and a molecular weight of 269.1 g/mol. IUPAC name: 4-chlorothieno[2,3-d]pyrimidine-6-sulfonyl chloride. InChIKey: BUWGXOIEWUGBOA-UHFFFAOYSA-N.

Identity
Molecular formulaC6H2Cl2N2O2S2
Molecular weight269.1 g/mol
IUPAC name4-chlorothieno[2,3-d]pyrimidine-6-sulfonyl chloride
InChIKeyBUWGXOIEWUGBOA-UHFFFAOYSA-N
SMILESC1=C(SC2=C1C(=NC=N2)Cl)S(=O)(=O)Cl

Computed by PubChem (NCBI)