Products 1955520-07-6

CAS 1955520-07-6 is the registry number for 2-Chlorothieno(3,2-d)pyrimidine-6-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2-chlorothieno[3,2-d]pyrimidine-6-sulfonyl chloride (CAS 1955520-07-6) is a chemical compound with the molecular formula C6H2Cl2N2O2S2 and a molecular weight of 269.1 g/mol. IUPAC name: 2-chlorothieno[3,2-d]pyrimidine-6-sulfonyl chloride. InChIKey: ZXHOBDIJCWMNEE-UHFFFAOYSA-N.

Identity
Molecular formulaC6H2Cl2N2O2S2
Molecular weight269.1 g/mol
IUPAC name2-chlorothieno[3,2-d]pyrimidine-6-sulfonyl chloride
InChIKeyZXHOBDIJCWMNEE-UHFFFAOYSA-N
SMILESC1=C(SC2=CN=C(N=C21)Cl)S(=O)(=O)Cl

Computed by PubChem (NCBI)