Products 1955520-07-6
CAS 1955520-07-6 is the registry number for 2-Chlorothieno(3,2-d)pyrimidine-6-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-chlorothieno[3,2-d]pyrimidine-6-sulfonyl chloride (CAS 1955520-07-6) is a chemical compound with the molecular formula C6H2Cl2N2O2S2 and a molecular weight of 269.1 g/mol. IUPAC name: 2-chlorothieno[3,2-d]pyrimidine-6-sulfonyl chloride. InChIKey: ZXHOBDIJCWMNEE-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl2N2O2S2 |
|---|---|
| Molecular weight | 269.1 g/mol |
| IUPAC name | 2-chlorothieno[3,2-d]pyrimidine-6-sulfonyl chloride |
| InChIKey | ZXHOBDIJCWMNEE-UHFFFAOYSA-N |
| SMILES | C1=C(SC2=CN=C(N=C21)Cl)S(=O)(=O)Cl |
Computed by PubChem (NCBI)