CAS 1001426-47-6 appears in our catalog under these names: 4-Aminotetrahydro-2H-thiopyran-4-carboxamide 1,1-dioxide, 95%, 4-Aminotetrahydro-2H-thiopyran-4-carboxamide 1,1-dioxide. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
4-amino-1,1-dioxothiane-4-carboxamide (CAS 1001426-47-6) is a chemical compound with the molecular formula C6H12N2O3S and a molecular weight of 192.24 g/mol. IUPAC name: 4-amino-1,1-dioxothiane-4-carboxamide. InChIKey: BKVFRYFPVXSHJI-UHFFFAOYSA-N.
| Molecular formula | C6H12N2O3S |
|---|---|
| Molecular weight | 192.24 g/mol |
| IUPAC name | 4-amino-1,1-dioxothiane-4-carboxamide |
| InChIKey | BKVFRYFPVXSHJI-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CCC1(C(=O)N)N |
Computed by PubChem (NCBI)