CAS 302581-27-7 is the registry number for 1-(3-Methyl-1,1-dioxidotetrahydrothiophen-3-yl)urea, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(3-methyl-1,1-dioxothiolan-3-yl)urea (CAS 302581-27-7) is a chemical compound with the molecular formula C6H12N2O3S and a molecular weight of 192.24 g/mol. IUPAC name: (3-methyl-1,1-dioxothiolan-3-yl)urea. InChIKey: VUOXNZDJJQRCBS-UHFFFAOYSA-N.
| Molecular formula | C6H12N2O3S |
|---|---|
| Molecular weight | 192.24 g/mol |
| IUPAC name | (3-methyl-1,1-dioxothiolan-3-yl)urea |
| InChIKey | VUOXNZDJJQRCBS-UHFFFAOYSA-N |
| SMILES | CC1(CCS(=O)(=O)C1)NC(=O)N |
Computed by PubChem (NCBI)