CAS 19647-70-2 appears in our catalog under these names: H-Cys(Acm)-OH 95% (hydrate), H-Cys(Acm)-OH, 95% (hydrate), 95% (hydrate), H-Cys(Acm)-OH. Offered by: Ambeed, Chemat, MedChemExpress. Available pack sizes: 250mg, 1g, 5g, 10g, 1 g, 5 g, 250 mg.
(2R)-3-(acetamidomethylsulfanyl)-2-aminopropanoic acid (CAS 19647-70-2) is a chemical compound with the molecular formula C6H12N2O3S and a molecular weight of 192.24 g/mol. IUPAC name: (2R)-3-(acetamidomethylsulfanyl)-2-aminopropanoic acid. InChIKey: QFQYGJMNIDGZSG-YFKPBYRVSA-N.
| Molecular formula | C6H12N2O3S |
|---|---|
| Molecular weight | 192.24 g/mol |
| IUPAC name | (2R)-3-(acetamidomethylsulfanyl)-2-aminopropanoic acid |
| InChIKey | QFQYGJMNIDGZSG-YFKPBYRVSA-N |
| SMILES | CC(=O)NCSC[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)