CAS 1001667-24-8 is the registry number for 1–((tert–Butoxycarbonyl)amino)–2–vinylcyclopropanecarboxylic acid. Offered by: GLPBio. Available pack sizes: 100mg.
2-ethenyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropane-1-carboxylic acid (CAS 1001667-24-8) is a chemical compound with the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. IUPAC name: 2-ethenyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropane-1-carboxylic acid. InChIKey: RFAQWADNTLIWMG-UHFFFAOYSA-N.
| Molecular formula | C11H17NO4 |
|---|---|
| Molecular weight | 227.26 g/mol |
| IUPAC name | 2-ethenyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropane-1-carboxylic acid |
| InChIKey | RFAQWADNTLIWMG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1(CC1C=C)C(=O)O |
Computed by PubChem (NCBI)