CAS 1001853-59-3 is the registry number for (S)-1-tert-Butyl 2-ethyl 4,4-difluoropyrrolidine-1,2-dicarboxylate, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
1-O-tert-butyl 2-O-ethyl (2S)-4,4-difluoropyrrolidine-1,2-dicarboxylate (CAS 1001853-59-3) is a chemical compound with the molecular formula C12H19F2NO4 and a molecular weight of 279.28 g/mol. IUPAC name: 1-O-tert-butyl 2-O-ethyl (2S)-4,4-difluoropyrrolidine-1,2-dicarboxylate. InChIKey: CMNMGOSQTYXYGN-QMMMGPOBSA-N.
| Molecular formula | C12H19F2NO4 |
|---|---|
| Molecular weight | 279.28 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-ethyl (2S)-4,4-difluoropyrrolidine-1,2-dicarboxylate |
| InChIKey | CMNMGOSQTYXYGN-QMMMGPOBSA-N |
| SMILES | CCOC(=O)[C@@H]1CC(CN1C(=O)OC(C)(C)C)(F)F |
Computed by PubChem (NCBI)