CAS 1523530-40-6 appears in our catalog under these names: Ethyl (r)-1-boc-4,4-difluoropyrrolidine-2-carboxylate, 95%, 1–tert–Butyl 2–ethyl (2R)–4,4–difluoropyrrolidine–1,2–dicarboxylate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 5g, 250mg, 1g, 100mg.
1-O-tert-butyl 2-O-ethyl (2R)-4,4-difluoropyrrolidine-1,2-dicarboxylate (CAS 1523530-40-6) is a chemical compound with the molecular formula C12H19F2NO4 and a molecular weight of 279.28 g/mol. IUPAC name: 1-O-tert-butyl 2-O-ethyl (2R)-4,4-difluoropyrrolidine-1,2-dicarboxylate. InChIKey: CMNMGOSQTYXYGN-MRVPVSSYSA-N.
| Molecular formula | C12H19F2NO4 |
|---|---|
| Molecular weight | 279.28 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-ethyl (2R)-4,4-difluoropyrrolidine-1,2-dicarboxylate |
| InChIKey | CMNMGOSQTYXYGN-MRVPVSSYSA-N |
| SMILES | CCOC(=O)[C@H]1CC(CN1C(=O)OC(C)(C)C)(F)F |
Computed by PubChem (NCBI)