CAS 1255667-06-1 appears in our catalog under these names: 1-tert-Butyl 3-methyl 5,5-difluoropiperidine-1,3-dicarboxylate, 96%, 1-tert-Butyl 3-methyl 5,5-difluoropiperidine-1,3-dicarboxylate 98%, 1-tert-butyl 3-methyl 5,5-difluoropiperidine-1,3-dicarboxylate, 98%, 98%, 1-tert-Butyl 3-methyl 5,5-difluoropiperidine-1,3-dicarboxylate, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g, 500mg, 10g.
1-O-tert-butyl 3-O-methyl 5,5-difluoropiperidine-1,3-dicarboxylate (CAS 1255667-06-1) is a chemical compound with the molecular formula C12H19F2NO4 and a molecular weight of 279.28 g/mol. IUPAC name: 1-O-tert-butyl 3-O-methyl 5,5-difluoropiperidine-1,3-dicarboxylate. InChIKey: MCMQSTZMIVFBRA-UHFFFAOYSA-N.
| Molecular formula | C12H19F2NO4 |
|---|---|
| Molecular weight | 279.28 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-methyl 5,5-difluoropiperidine-1,3-dicarboxylate |
| InChIKey | MCMQSTZMIVFBRA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(CC(C1)(F)F)C(=O)OC |
Computed by PubChem (NCBI)