Products 1001907-54-5

CAS 1001907-54-5 is the registry number for 2-{1-((Prop-2-en-1-ylsulfanyl)methyl)cyclopropyl}acetic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

2-[1-(prop-2-enylsulfanylmethyl)cyclopropyl]acetic acid (CAS 1001907-54-5) is a chemical compound with the molecular formula C9H14O2S and a molecular weight of 186.27 g/mol. IUPAC name: 2-[1-(prop-2-enylsulfanylmethyl)cyclopropyl]acetic acid. InChIKey: DZKGIJIEFLDZOV-UHFFFAOYSA-N.

Identity
Molecular formulaC9H14O2S
Molecular weight186.27 g/mol
IUPAC name2-[1-(prop-2-enylsulfanylmethyl)cyclopropyl]acetic acid
InChIKeyDZKGIJIEFLDZOV-UHFFFAOYSA-N
SMILESC=CCSCC1(CC1)CC(=O)O

Computed by PubChem (NCBI)