Products 1780589-66-3

CAS 1780589-66-3 is the registry number for 2-(3,6-Dihydro-2H-thiopyran-4-yl)-2-methylpropanoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2-(3,6-dihydro-2H-thiopyran-4-yl)-2-methylpropanoic acid (CAS 1780589-66-3) is a chemical compound with the molecular formula C9H14O2S and a molecular weight of 186.27 g/mol. IUPAC name: 2-(3,6-dihydro-2H-thiopyran-4-yl)-2-methylpropanoic acid. InChIKey: QBAATZQWEYNRKP-UHFFFAOYSA-N.

Identity
Molecular formulaC9H14O2S
Molecular weight186.27 g/mol
IUPAC name2-(3,6-dihydro-2H-thiopyran-4-yl)-2-methylpropanoic acid
InChIKeyQBAATZQWEYNRKP-UHFFFAOYSA-N
SMILESCC(C)(C1=CCSCC1)C(=O)O

Computed by PubChem (NCBI)