Products 2138074-61-8

CAS 2138074-61-8 is the registry number for 3-Methyl-8-thiabicyclo(3.2.1)octane-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

3-methyl-8-thiabicyclo[3.2.1]octane-3-carboxylic acid (CAS 2138074-61-8) is a chemical compound with the molecular formula C9H14O2S and a molecular weight of 186.27 g/mol. IUPAC name: 3-methyl-8-thiabicyclo[3.2.1]octane-3-carboxylic acid. InChIKey: URBMKHBXNCRSQO-UHFFFAOYSA-N.

Identity
Molecular formulaC9H14O2S
Molecular weight186.27 g/mol
IUPAC name3-methyl-8-thiabicyclo[3.2.1]octane-3-carboxylic acid
InChIKeyURBMKHBXNCRSQO-UHFFFAOYSA-N
SMILESCC1(CC2CCC(C1)S2)C(=O)O

Computed by PubChem (NCBI)