Products 1002-79-5

CAS 1002-79-5 is the registry number for Conjugated Linoleic Acid Methyl Ester, 90% (Mixture of Isomers). Offered by: TRC. Available pack sizes: 50mg.

Structural formula: {0} (CAS {1})

Methyl (10E,12E)-octadeca-10,12-dienoate (CAS 1002-79-5) is a chemical compound with the molecular formula C19H34O2 and a molecular weight of 294.5 g/mol. IUPAC name: methyl (10E,12E)-octadeca-10,12-dienoate. InChIKey: KMXSXYSNZMSDFK-XBLVEGMJSA-N.

Identity
Molecular formulaC19H34O2
Molecular weight294.5 g/mol
IUPAC namemethyl (10E,12E)-octadeca-10,12-dienoate
InChIKeyKMXSXYSNZMSDFK-XBLVEGMJSA-N
SMILESCCCCC/C=C/C=C/CCCCCCCCC(=O)OC

Computed by PubChem (NCBI)