Products 13058-52-1
CAS 13058-52-1 appears in our catalog under these names: (9Z,11E)-methyl octadeca-9,11-dienoate, (9Z,11E)-Methyl Ester 9,11-Octadecadienoate, 9(Z),11(E)–Conjugated Linoleic Acid methyl ester, 9(Z),11(E)-Conjugated linoleic acid methyl ester, 99.2%. Offered by: Chemat Brand, TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: on request, 10mg, 2,5mg, 25mg, 5mg, 50mg, 100mg, 5 mg.
Methyl (9Z,11E)-octadeca-9,11-dienoate (CAS 13058-52-1) is a chemical compound with the molecular formula C19H34O2 and a molecular weight of 294.5 g/mol. IUPAC name: methyl (9Z,11E)-octadeca-9,11-dienoate. InChIKey: KVIWYYOMPLJRMC-OCBXPSTGSA-N.
| Molecular formula | C19H34O2 |
|---|---|
| Molecular weight | 294.5 g/mol |
| IUPAC name | methyl (9Z,11E)-octadeca-9,11-dienoate |
| InChIKey | KVIWYYOMPLJRMC-OCBXPSTGSA-N |
| SMILES | CCCCCC/C=C/C=C\CCCCCCCC(=O)OC |
Computed by PubChem (NCBI)
Synonyms:
9,11-Octadecadienoic acid, methyl ester, (9Z,11E)-, Bovinic acid methyl ester, Rumenic acid methyl ester, Methyl linoleate, (9Z,11E)-, Methyl 9-cis-11-trans-linoleate, (9Z,11E)-Octadecadienoic acid methyl ester, Methyl (9Z,11E)-octadecadienoate, 9,11-Octadecadienoic acid, methyl ester, (E,Z)-, (9Z,11E)-methyl octadeca-9,11-dienoate, (9Z,11E)-Methyl Ester 9,11-Octadecadienoate