Products 13038-47-6
CAS 13038-47-6 appears in our catalog under these names: 9(E),11(E)–Conjugated Linoleic Acid methyl ester, 9(E),11(E)-Conjugated Linoleic Acid methyl ester, 98%, 98%, (9E,11E)-9,11-Octadecadienoic acid methyl ester. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 25mg, 5 mg, 10 mg, 25 mg.
Methyl (9E,11E)-octadeca-9,11-dienoate (CAS 13038-47-6) is a chemical compound with the molecular formula C19H34O2 and a molecular weight of 294.5 g/mol. IUPAC name: methyl (9E,11E)-octadeca-9,11-dienoate. InChIKey: KVIWYYOMPLJRMC-BNFZFUHLSA-N.
| Molecular formula | C19H34O2 |
|---|---|
| Molecular weight | 294.5 g/mol |
| IUPAC name | methyl (9E,11E)-octadeca-9,11-dienoate |
| InChIKey | KVIWYYOMPLJRMC-BNFZFUHLSA-N |
| SMILES | CCCCCC/C=C/C=C/CCCCCCCC(=O)OC |
Computed by PubChem (NCBI)
Synonyms:
Methyl-9,11-octadecadienoate, Methyl 9,11-octadecadienoate, (E,E)-, 9,11-Octadecadienoic acid, methyl ester, (9E,11E)-, methyl (9E,11E)-octadeca-9,11-dienoate, (9E,11E)-9,11-Octadecadienoic acid methyl ester, 9(E),11(E)-Conjugated Linoleic Acid methyl ester, 9(Z),11(E)-Conjugated linoleic acid methyl ester, 9(Z),11(Z)-Conjugated linoleic acid methyl ester, methyl isolinoleate, Methyl ester of cla (9-cis,11-trans)