CAS 1002359-95-6 is the registry number for (R)-tert-Butyl 3-(methylsulfonamidomethyl)piperidine-1-carboxylate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (3R)-3-(methanesulfonamidomethyl)piperidine-1-carboxylate (CAS 1002359-95-6) is a chemical compound with the molecular formula C12H24N2O4S and a molecular weight of 292.40 g/mol. IUPAC name: tert-butyl (3R)-3-(methanesulfonamidomethyl)piperidine-1-carboxylate. InChIKey: AOVBETVUJPUVSZ-JTQLQIEISA-N.
| Molecular formula | C12H24N2O4S |
|---|---|
| Molecular weight | 292.40 g/mol |
| IUPAC name | tert-butyl (3R)-3-(methanesulfonamidomethyl)piperidine-1-carboxylate |
| InChIKey | AOVBETVUJPUVSZ-JTQLQIEISA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H](C1)CNS(=O)(=O)C |
Computed by PubChem (NCBI)