CAS 1807938-41-5 is the registry number for tert-Butyl N-((1R,2R)-2-methanesulfonamidocyclohexyl)carbamate, 95%. Offered by: AmBeed. Available pack sizes: 5g.
Tert-butyl N-[(1R,2R)-2-(methanesulfonamido)cyclohexyl]carbamate (CAS 1807938-41-5) is a chemical compound with the molecular formula C12H24N2O4S and a molecular weight of 292.40 g/mol. IUPAC name: tert-butyl N-[(1R,2R)-2-(methanesulfonamido)cyclohexyl]carbamate. InChIKey: KMVMKPZNXJYXDO-NXEZZACHSA-N.
| Molecular formula | C12H24N2O4S |
|---|---|
| Molecular weight | 292.40 g/mol |
| IUPAC name | tert-butyl N-[(1R,2R)-2-(methanesulfonamido)cyclohexyl]carbamate |
| InChIKey | KMVMKPZNXJYXDO-NXEZZACHSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCCC[C@H]1NS(=O)(=O)C |
Computed by PubChem (NCBI)